C26H29F4N5O3S — CID 122632232
N-(4-fluorophenyl)-2-[4-(4-pentoxyphenyl)sulfonylpiperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 122632232) has the molecular formula C26H29F4N5O3S and a molecular weight of 567.61 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-(4-pentoxyphenyl)sulfonylpiperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(4-fluorophenyl)-2-[4-(4-pentoxyphenyl)sulfonylpiperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 122632232 |
| Molecular Formula | C26H29F4N5O3S |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-(4-pentoxyphenyl)sulfonylpiperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCCCCOc1ccc(S(=O)(=O)N2CCN(c3nc(Nc4ccc(F)cc4)cc(C(F)(F)F)n3)CC2)cc1 |
| InChI | InChI=1S/C26H29F4N5O3S/c1-2-3-4-17-38-21-9-11-22(12-10-21)39(36,37)35-15-13-34(14-16-35)25-32-23(26(28,29)30)18-24(33-25)31-20-7-5-19(27)6-8-20/h5-12,18H,2-4,13-17H2,1H3,(H,31,32,33) |
| InChIKey | KVRKDRJOVYSRGF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|