C35H41N7O4 — CID 122633400
N-[5-[(3,5-ditert-butylbenzoyl)amino]-2-methylphenyl]-4-(methylamino)-2-(4-methyl-3-nitroanilino)pyrimidine-5-carboxamide (PubChem CID 122633400) has the molecular formula C35H41N7O4 and a molecular weight of 623.76 g/mol. Its IUPAC name is N-[5-[(3,5-ditert-butylbenzoyl)amino]-2-methylphenyl]-4-(methylamino)-2-(4-methyl-3-nitroanilino)pyrimidine-5-carboxamide.
| Compound Name | N-[5-[(3,5-ditert-butylbenzoyl)amino]-2-methylphenyl]-4-(methylamino)-2-(4-methyl-3-nitroanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122633400 |
| Molecular Formula | C35H41N7O4 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.32 |
| IUPAC Name | N-[5-[(3,5-ditert-butylbenzoyl)amino]-2-methylphenyl]-4-(methylamino)-2-(4-methyl-3-nitroanilino)pyrimidine-5-carboxamide |
| SMILES | CNc1nc(Nc2ccc(C)c([N+](=O)[O-])c2)ncc1C(=O)Nc1cc(NC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)ccc1C |
| InChI | InChI=1S/C35H41N7O4/c1-20-10-12-25(38-31(43)22-14-23(34(3,4)5)16-24(15-22)35(6,7)8)17-28(20)40-32(44)27-19-37-33(41-30(27)36-9)39-26-13-11-21(2)29(18-26)42(45)46/h10-19H,1-9H3,(H,38,43)(H,40,44)(H2,36,37,39,41) |
| InChIKey | PTYZPYBXEDZOND-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 151.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|