C33H31N7O2 — CID 122633872
2-(3-amino-4-methylanilino)-4-(methylamino)-N-[2-methyl-5-[(3-phenylbenzoyl)amino]phenyl]pyrimidine-5-carboxamide (PubChem CID 122633872) has the molecular formula C33H31N7O2 and a molecular weight of 557.66 g/mol. Its IUPAC name is 2-(3-amino-4-methylanilino)-4-(methylamino)-N-[2-methyl-5-[(3-phenylbenzoyl)amino]phenyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(3-amino-4-methylanilino)-4-(methylamino)-N-[2-methyl-5-[(3-phenylbenzoyl)amino]phenyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122633872 |
| Molecular Formula | C33H31N7O2 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 2-(3-amino-4-methylanilino)-4-(methylamino)-N-[2-methyl-5-[(3-phenylbenzoyl)amino]phenyl]pyrimidine-5-carboxamide |
| SMILES | CNc1nc(Nc2ccc(C)c(N)c2)ncc1C(=O)Nc1cc(NC(=O)c2cccc(-c3ccccc3)c2)ccc1C |
| InChI | InChI=1S/C33H31N7O2/c1-20-12-14-25(17-28(20)34)38-33-36-19-27(30(35-3)40-33)32(42)39-29-18-26(15-13-21(29)2)37-31(41)24-11-7-10-23(16-24)22-8-5-4-6-9-22/h4-19H,34H2,1-3H3,(H,37,41)(H,39,42)(H2,35,36,38,40) |
| InChIKey | NGIXUSIDPQROQD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|