C36H32N6O5 — CID 139753100
1-N,3-N-bis[3-[(3-aminobenzoyl)amino]-4-methylphenyl]-4-hydroxybenzene-1,3-dicarboxamide (PubChem CID 139753100) has the molecular formula C36H32N6O5 and a molecular weight of 628.69 g/mol. Its IUPAC name is 1-N,3-N-bis[3-[(3-aminobenzoyl)amino]-4-methylphenyl]-4-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[3-[(3-aminobenzoyl)amino]-4-methylphenyl]-4-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139753100 |
| Molecular Formula | C36H32N6O5 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.24 |
| IUPAC Name | 1-N,3-N-bis[3-[(3-aminobenzoyl)amino]-4-methylphenyl]-4-hydroxybenzene-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(O)c(C(=O)Nc3ccc(C)c(NC(=O)c4cccc(N)c4)c3)c2)cc1NC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C36H32N6O5/c1-20-9-12-27(18-30(20)41-34(45)22-5-3-7-25(37)15-22)39-33(44)24-11-14-32(43)29(17-24)36(47)40-28-13-10-21(2)31(19-28)42-35(46)23-6-4-8-26(38)16-23/h3-19,43H,37-38H2,1-2H3,(H,39,44)(H,40,47)(H,41,45)(H,42,46) |
| InChIKey | YYINTWAMOXMXJV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 188.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|