C28H23N5O — CID 58829887
2-anilino-N-[4-[2-(methylamino)quinazolin-6-yl]phenyl]benzamide (PubChem CID 58829887) has the molecular formula C28H23N5O and a molecular weight of 445.53 g/mol. Its IUPAC name is 2-anilino-N-[4-[2-(methylamino)quinazolin-6-yl]phenyl]benzamide.
| Compound Name | 2-anilino-N-[4-[2-(methylamino)quinazolin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 58829887 |
| Molecular Formula | C28H23N5O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-anilino-N-[4-[2-(methylamino)quinazolin-6-yl]phenyl]benzamide |
| SMILES | CNc1ncc2cc(-c3ccc(NC(=O)c4ccccc4Nc4ccccc4)cc3)ccc2n1 |
| InChI | InChI=1S/C28H23N5O/c1-29-28-30-18-21-17-20(13-16-25(21)33-28)19-11-14-23(15-12-19)32-27(34)24-9-5-6-10-26(24)31-22-7-3-2-4-8-22/h2-18,31H,1H3,(H,32,34)(H,29,30,33) |
| InChIKey | PHLZWGLSEXLHDI-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |