C21H18ClN7O2 — CID 122635742
[3-(4-chlorophenyl)-5-(5-methyltetrazol-1-yl)phenyl] N-(1-pyrazin-2-ylethyl)carbamate (PubChem CID 122635742) has the molecular formula C21H18ClN7O2 and a molecular weight of 435.88 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-5-(5-methyltetrazol-1-yl)phenyl] N-(1-pyrazin-2-ylethyl)carbamate.
| Compound Name | [3-(4-chlorophenyl)-5-(5-methyltetrazol-1-yl)phenyl] N-(1-pyrazin-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 122635742 |
| Molecular Formula | C21H18ClN7O2 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [3-(4-chlorophenyl)-5-(5-methyltetrazol-1-yl)phenyl] N-(1-pyrazin-2-ylethyl)carbamate |
| SMILES | Cc1nnnn1-c1cc(OC(=O)NC(C)c2cnccn2)cc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H18ClN7O2/c1-13(20-12-23-7-8-24-20)25-21(30)31-19-10-16(15-3-5-17(22)6-4-15)9-18(11-19)29-14(2)26-27-28-29/h3-13H,1-2H3,(H,25,30) |
| InChIKey | UMECALNYTMUCRA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |