C18H13Cl3N6O3S — CID 122635853
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[4-(3,4,5-trichlorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 122635853) has the molecular formula C18H13Cl3N6O3S and a molecular weight of 499.77 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[4-(3,4,5-trichlorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[4-(3,4,5-trichlorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 122635853 |
| Molecular Formula | C18H13Cl3N6O3S |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[4-(3,4,5-trichlorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2nc(-c3cc(Cl)c(Cl)c(Cl)c3)cs2)n(C)c1=O |
| InChI | InChI=1S/C18H13Cl3N6O3S/c1-25-15-14(16(29)26(2)18(25)30)27(7-22-15)5-12(28)24-17-23-11(6-31-17)8-3-9(19)13(21)10(20)4-8/h3-4,6-7H,5H2,1-2H3,(H,23,24,28) |
| InChIKey | MFBPQNSBMJDPRF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|