C23H24Cl2N6O4S — CID 88573480
N-[4-(3,5-dichloro-4-pentoxyphenyl)-1,3-thiazol-2-yl]-2-(4,6-dimethyl-5,7-dioxopyrazolo[4,5-d]pyrimidin-1-yl)acetamide (PubChem CID 88573480) has the molecular formula C23H24Cl2N6O4S and a molecular weight of 551.46 g/mol. Its IUPAC name is N-[4-(3,5-dichloro-4-pentoxyphenyl)-1,3-thiazol-2-yl]-2-(4,6-dimethyl-5,7-dioxopyrazolo[4,5-d]pyrimidin-1-yl)acetamide.
| Compound Name | N-[4-(3,5-dichloro-4-pentoxyphenyl)-1,3-thiazol-2-yl]-2-(4,6-dimethyl-5,7-dioxopyrazolo[4,5-d]pyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 88573480 |
| Molecular Formula | C23H24Cl2N6O4S |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | N-[4-(3,5-dichloro-4-pentoxyphenyl)-1,3-thiazol-2-yl]-2-(4,6-dimethyl-5,7-dioxopyrazolo[4,5-d]pyrimidin-1-yl)acetamide |
| SMILES | CCCCCOc1c(Cl)cc(-c2csc(NC(=O)Cn3ncc4c3c(=O)n(C)c(=O)n4C)n2)cc1Cl |
| InChI | InChI=1S/C23H24Cl2N6O4S/c1-4-5-6-7-35-20-14(24)8-13(9-15(20)25)16-12-36-22(27-16)28-18(32)11-31-19-17(10-26-31)29(2)23(34)30(3)21(19)33/h8-10,12H,4-7,11H2,1-3H3,(H,27,28,32) |
| InChIKey | BIHRBHUEZQMWKF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|