C23H25ClN6O4S — CID 88573446
N-[4-(3-chloro-4-pentoxyphenyl)-1,3-thiazol-2-yl]-2-(4,6-dimethyl-5,7-dioxopyrazolo[4,5-d]pyrimidin-1-yl)acetamide (PubChem CID 88573446) has the molecular formula C23H25ClN6O4S and a molecular weight of 517.01 g/mol. Its IUPAC name is N-[4-(3-chloro-4-pentoxyphenyl)-1,3-thiazol-2-yl]-2-(4,6-dimethyl-5,7-dioxopyrazolo[4,5-d]pyrimidin-1-yl)acetamide.
| Compound Name | N-[4-(3-chloro-4-pentoxyphenyl)-1,3-thiazol-2-yl]-2-(4,6-dimethyl-5,7-dioxopyrazolo[4,5-d]pyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 88573446 |
| Molecular Formula | C23H25ClN6O4S |
| Molecular Weight | 517.01 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | N-[4-(3-chloro-4-pentoxyphenyl)-1,3-thiazol-2-yl]-2-(4,6-dimethyl-5,7-dioxopyrazolo[4,5-d]pyrimidin-1-yl)acetamide |
| SMILES | CCCCCOc1ccc(-c2csc(NC(=O)Cn3ncc4c3c(=O)n(C)c(=O)n4C)n2)cc1Cl |
| InChI | InChI=1S/C23H25ClN6O4S/c1-4-5-6-9-34-18-8-7-14(10-15(18)24)16-13-35-22(26-16)27-19(31)12-30-20-17(11-25-30)28(2)23(33)29(3)21(20)32/h7-8,10-11,13H,4-6,9,12H2,1-3H3,(H,26,27,31) |
| InChIKey | VFURNFHXGPZXOP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.01 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|