C24H27ClN6O5S — CID 53390570
N-[4-[3-chloro-4-(2,2-dimethylpropoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,9-trimethyl-2,6,8-trioxopurin-7-yl)acetamide (PubChem CID 53390570) has the molecular formula C24H27ClN6O5S and a molecular weight of 547.04 g/mol. Its IUPAC name is N-[4-[3-chloro-4-(2,2-dimethylpropoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,9-trimethyl-2,6,8-trioxopurin-7-yl)acetamide.
| Compound Name | N-[4-[3-chloro-4-(2,2-dimethylpropoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,9-trimethyl-2,6,8-trioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 53390570 |
| Molecular Formula | C24H27ClN6O5S |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | N-[4-[3-chloro-4-(2,2-dimethylpropoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,9-trimethyl-2,6,8-trioxopurin-7-yl)acetamide |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)n(C)c(=O)n2CC(=O)Nc1nc(-c2ccc(OCC(C)(C)C)c(Cl)c2)cs1 |
| InChI | InChI=1S/C24H27ClN6O5S/c1-24(2,3)12-36-16-8-7-13(9-14(16)25)15-11-37-21(26-15)27-17(32)10-31-18-19(29(5)23(31)35)28(4)22(34)30(6)20(18)33/h7-9,11H,10,12H2,1-6H3,(H,26,27,32) |
| InChIKey | RAJPQRLGGKGBRU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |