C21H17F4N5O3S — CID 86762207
N-[4-[3-fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)acetamide (PubChem CID 86762207) has the molecular formula C21H17F4N5O3S and a molecular weight of 495.46 g/mol. Its IUPAC name is N-[4-[3-fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)acetamide.
| Compound Name | N-[4-[3-fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 86762207 |
| Molecular Formula | C21H17F4N5O3S |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | N-[4-[3-fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)acetamide |
| SMILES | Cc1cc2c(c(=O)n(C)c(=O)n2C)n1CC(=O)Nc1nc(-c2ccc(C(F)(F)F)c(F)c2)cs1 |
| InChI | InChI=1S/C21H17F4N5O3S/c1-10-6-15-17(18(32)29(3)20(33)28(15)2)30(10)8-16(31)27-19-26-14(9-34-19)11-4-5-12(13(22)7-11)21(23,24)25/h4-7,9H,8H2,1-3H3,(H,26,27,31) |
| InChIKey | DVEXKZCKMAEQGO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |