C19H13F4N5O4S — CID 53390111
2-(5,7-dimethyl-4,6-dioxo-[1,2]oxazolo[3,4-d]pyrimidin-3-yl)-N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 53390111) has the molecular formula C19H13F4N5O4S and a molecular weight of 483.40 g/mol. Its IUPAC name is 2-(5,7-dimethyl-4,6-dioxo-[1,2]oxazolo[3,4-d]pyrimidin-3-yl)-N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(5,7-dimethyl-4,6-dioxo-[1,2]oxazolo[3,4-d]pyrimidin-3-yl)-N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 53390111 |
| Molecular Formula | C19H13F4N5O4S |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 2-(5,7-dimethyl-4,6-dioxo-[1,2]oxazolo[3,4-d]pyrimidin-3-yl)-N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | Cn1c(=O)c2c(CC(=O)Nc3nc(-c4ccc(F)c(C(F)(F)F)c4)cs3)onc2n(C)c1=O |
| InChI | InChI=1S/C19H13F4N5O4S/c1-27-15-14(16(30)28(2)18(27)31)12(32-26-15)6-13(29)25-17-24-11(7-33-17)8-3-4-10(20)9(5-8)19(21,22)23/h3-5,7H,6H2,1-2H3,(H,24,25,29) |
| InChIKey | KHHQGOPHBXCKRZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |