C20H13F5KN4O3S2 — CID 118023868
CID 118023868 (PubChem CID 118023868) has the molecular formula C20H13F5KN4O3S2 and a molecular weight of 555.57 g/mol.
| Compound Name | CID 118023868 |
|---|---|
| PubChem CID | 118023868 |
| Molecular Formula | C20H13F5KN4O3S2 |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | — |
| SMILES | Cn1c(=O)c2c(CC(=O)Nc3nc(-c4ccc(F)c(C(F)(F)F)c4F)cs3)csc2n(C)c1=O.[K] |
| InChI | InChI=1S/C20H13F5N4O3S2.K/c1-28-16(31)13-8(6-33-17(13)29(2)19(28)32)5-12(30)27-18-26-11(7-34-18)9-3-4-10(21)14(15(9)22)20(23,24)25;/h3-4,6-7H,5H2,1-2H3,(H,26,27,30); |
| InChIKey | ZROMZAGVBVNUBJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |