C21H16F4N4O4S — CID 46918029
N-[4-[2-fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide (PubChem CID 46918029) has the molecular formula C21H16F4N4O4S and a molecular weight of 496.44 g/mol. Its IUPAC name is N-[4-[2-fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide.
| Compound Name | N-[4-[2-fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 46918029 |
| Molecular Formula | C21H16F4N4O4S |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | N-[4-[2-fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
| SMILES | Cc1oc2c(c1CC(=O)Nc1nc(-c3ccc(C(F)(F)F)cc3F)cs1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C21H16F4N4O4S/c1-9-12(16-17(31)28(2)20(32)29(3)18(16)33-9)7-15(30)27-19-26-14(8-34-19)11-5-4-10(6-13(11)22)21(23,24)25/h4-6,8H,7H2,1-3H3,(H,26,27,30) |
| InChIKey | GDGPROVRKWVGIM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |