C22H18F4N4O5S — CID 46918233
N-[4-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide (PubChem CID 46918233) has the molecular formula C22H18F4N4O5S and a molecular weight of 526.47 g/mol. Its IUPAC name is N-[4-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide.
| Compound Name | N-[4-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 46918233 |
| Molecular Formula | C22H18F4N4O5S |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | N-[4-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
| SMILES | Cc1oc2c(c1CC(=O)Nc1nc(-c3ccc(OCC(F)(F)F)c(F)c3)cs1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C22H18F4N4O5S/c1-10-12(17-18(32)29(2)21(33)30(3)19(17)35-10)7-16(31)28-20-27-14(8-36-20)11-4-5-15(13(23)6-11)34-9-22(24,25)26/h4-6,8H,7,9H2,1-3H3,(H,27,28,31) |
| InChIKey | OKXOGXTYENJNIN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |