C30H35NO4 — CID 122636784
(1R,1aR,6aS)-5-[(1R)-1-[2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propoxy]ethyl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid (PubChem CID 122636784) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is (1R,1aR,6aS)-5-[(1R)-1-[2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propoxy]ethyl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid.
| Compound Name | (1R,1aR,6aS)-5-[(1R)-1-[2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propoxy]ethyl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
|---|---|
| PubChem CID | 122636784 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (1R,1aR,6aS)-5-[(1R)-1-[2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propoxy]ethyl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
| SMILES | C[C@@H](OCC(O)CNC(C)(C)Cc1ccc2ccccc2c1)c1cccc2c1C[C@@H]1[C@@H](C(=O)O)[C@H]21 |
| InChI | InChI=1S/C30H35NO4/c1-18(23-9-6-10-24-25(23)14-26-27(24)28(26)29(33)34)35-17-22(32)16-31-30(2,3)15-19-11-12-20-7-4-5-8-21(20)13-19/h4-13,18,22,26-28,31-32H,14-17H2,1-3H3,(H,33,34)/t18-,22?,26+,27-,28-/m1/s1 |
| InChIKey | BEJGSOJGVMJOOQ-CEMLZEMOSA-N |
| XLogP | 4.86 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |