C12H11F3N2O2 — CID 122640222
3-(4-cyanophenyl)-4,4,4-trifluoro-2-hydroxy-2-methylbutanamide (PubChem CID 122640222) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-4,4,4-trifluoro-2-hydroxy-2-methylbutanamide.
| Compound Name | 3-(4-cyanophenyl)-4,4,4-trifluoro-2-hydroxy-2-methylbutanamide |
|---|---|
| PubChem CID | 122640222 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-(4-cyanophenyl)-4,4,4-trifluoro-2-hydroxy-2-methylbutanamide |
| SMILES | CC(O)(C(N)=O)C(c1ccc(C#N)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O2/c1-11(19,10(17)18)9(12(13,14)15)8-4-2-7(6-16)3-5-8/h2-5,9,19H,1H3,(H2,17,18) |
| InChIKey | XHJVFQXRCFUSQQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |