C21H30N2O2 — CID 122641259
[4-[[[2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]methyl]cyclohexyl]carbamic acid (PubChem CID 122641259) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is [4-[[[2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]methyl]cyclohexyl]carbamic acid.
| Compound Name | [4-[[[2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]methyl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 122641259 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | [4-[[[2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]methyl]cyclohexyl]carbamic acid |
| SMILES | CC/C(=C\c1ccccc1)C1CC1NCC1CCC(NC(=O)O)CC1 |
| InChI | InChI=1S/C21H30N2O2/c1-2-17(12-15-6-4-3-5-7-15)19-13-20(19)22-14-16-8-10-18(11-9-16)23-21(24)25/h3-7,12,16,18-20,22-23H,2,8-11,13-14H2,1H3,(H,24,25)/b17-12+ |
| InChIKey | GWEMYANQJQYXKI-SFQUDFHCSA-N |
| XLogP | 4.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |