About (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one
(4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one (PubChem CID 134481119) has the molecular formula C18H24N2O
and a molecular weight of 284.40 g/mol. Its IUPAC name is (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one.
Molecular Properties
| Compound Name | (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one |
| PubChem CID | 134481119 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one |
| SMILES | CC/C(=C\c1ccccc1)[C@H]1C[C@@H]1N[C@H]1CCNC(=O)C1 |
| InChI | InChI=1S/C18H24N2O/c1-2-14(10-13-6-4-3-5-7-13)16-12-17(16)20-15-8-9-19-18(21)11-15/h3-7,10,15-17,20H,2,8-9,11-12H2,1H3,(H,19,21)/b14-10+/t15-,16+,17-/m0/s1 |
| InChIKey | VPEBWAIWTLDBCH-MHHBOCFLSA-N |
| XLogP | 2.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one?
The IUPAC name of (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one (CID 134481119) is (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one.
What is the SMILES notation for (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one?
The canonical SMILES for (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one is CC/C(=C\c1ccccc1)[C@H]1C[C@@H]1N[C@H]1CCNC(=O)C1.
What is the InChIKey of (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one?
The InChIKey is VPEBWAIWTLDBCH-MHHBOCFLSA-N. The full InChI is InChI=1S/C18H24N2O/c1-2-14(10-13-6-4-3-5-7-13)16-12-17(16)20-15-8-9-19-18(21)11-15/h3-7,10,15-17,20H,2,8-9,11-12H2,1H3,(H,19,21)/b14-10+/t15-,16+,17-/m0/s1.
What are the key properties of (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one?
(4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one has a molecular weight of 284.40 g/mol, XLogP of 2.74, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[[(1S,2R)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]piperidin-2-one is sourced from PubChem (CID 134481119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).