C23H35N3S — CID 134469090
1-[2-(cyclopropylsulfanylamino)ethyl]-N-[(1R,2S)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]piperidin-4-amine (PubChem CID 134469090) has the molecular formula C23H35N3S and a molecular weight of 385.62 g/mol. Its IUPAC name is 1-[2-(cyclopropylsulfanylamino)ethyl]-N-[(1R,2S)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]piperidin-4-amine.
| Compound Name | 1-[2-(cyclopropylsulfanylamino)ethyl]-N-[(1R,2S)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]piperidin-4-amine |
|---|---|
| PubChem CID | 134469090 |
| Molecular Formula | C23H35N3S |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 1-[2-(cyclopropylsulfanylamino)ethyl]-N-[(1R,2S)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]piperidin-4-amine |
| SMILES | CC/C(=C\c1ccccc1)[C@@H]1C[C@H]1NC1CCN(CCNSC2CC2)CC1 |
| InChI | InChI=1S/C23H35N3S/c1-2-19(16-18-6-4-3-5-7-18)22-17-23(22)25-20-10-13-26(14-11-20)15-12-24-27-21-8-9-21/h3-7,16,20-25H,2,8-15,17H2,1H3/b19-16+/t22-,23+/m0/s1 |
| InChIKey | AZEZFPOMUXGWDG-NQWVBACPSA-N |
| XLogP | 4.32 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|