C23H14F3N5O2 — CID 122642329
2-[2-(hydroxymethyl)pyrimidin-5-yl]-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one (PubChem CID 122642329) has the molecular formula C23H14F3N5O2 and a molecular weight of 449.39 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)pyrimidin-5-yl]-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one.
| Compound Name | 2-[2-(hydroxymethyl)pyrimidin-5-yl]-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
|---|---|
| PubChem CID | 122642329 |
| Molecular Formula | C23H14F3N5O2 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-[2-(hydroxymethyl)pyrimidin-5-yl]-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
| SMILES | O=c1ccc2cnc3ccc(-c4cnc(CO)nc4)nc3c2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H14F3N5O2/c24-23(25,26)15-2-1-3-16(8-15)31-20(33)7-4-13-9-27-18-6-5-17(30-21(18)22(13)31)14-10-28-19(12-32)29-11-14/h1-11,32H,12H2 |
| InChIKey | OCGTZLWDSMUOBR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|