C18H24N4O — CID 122643159
1-[2-(cycloheptylamino)-5,5-dimethyl-7H-pyrrolo[3,4-d]pyrimidin-6-yl]prop-2-yn-1-one (PubChem CID 122643159) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-[2-(cycloheptylamino)-5,5-dimethyl-7H-pyrrolo[3,4-d]pyrimidin-6-yl]prop-2-yn-1-one.
| Compound Name | 1-[2-(cycloheptylamino)-5,5-dimethyl-7H-pyrrolo[3,4-d]pyrimidin-6-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 122643159 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-[2-(cycloheptylamino)-5,5-dimethyl-7H-pyrrolo[3,4-d]pyrimidin-6-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1Cc2nc(NC3CCCCCC3)ncc2C1(C)C |
| InChI | InChI=1S/C18H24N4O/c1-4-16(23)22-12-15-14(18(22,2)3)11-19-17(21-15)20-13-9-7-5-6-8-10-13/h1,11,13H,5-10,12H2,2-3H3,(H,19,20,21) |
| InChIKey | NGICTUGKQCGPPO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|