C29H32N6O2 — CID 122644007
N-(3,5-dimethoxyphenyl)-N-[2-(3-ethynylpiperidin-1-yl)ethyl]-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine (PubChem CID 122644007) has the molecular formula C29H32N6O2 and a molecular weight of 496.62 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-N-[2-(3-ethynylpiperidin-1-yl)ethyl]-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-N-[2-(3-ethynylpiperidin-1-yl)ethyl]-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 122644007 |
| Molecular Formula | C29H32N6O2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-N-[2-(3-ethynylpiperidin-1-yl)ethyl]-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine |
| SMILES | C#CC1CCCN(CCN(c2cc(OC)cc(OC)c2)c2ccc3ncc(-c4cnn(C)c4)nc3c2)C1 |
| InChI | InChI=1S/C29H32N6O2/c1-5-21-7-6-10-34(19-21)11-12-35(24-13-25(36-3)16-26(14-24)37-4)23-8-9-27-28(15-23)32-29(18-30-27)22-17-31-33(2)20-22/h1,8-9,13-18,20-21H,6-7,10-12,19H2,2-4H3 |
| InChIKey | GZDCIFVCDYQAQP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|