C23H22BN5O — CID 88888571
CID 88888571 (PubChem CID 88888571) has the molecular formula C23H22BN5O and a molecular weight of 395.28 g/mol.
| Compound Name | CID 88888571 |
|---|---|
| PubChem CID | 88888571 |
| Molecular Formula | C23H22BN5O |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | — |
| SMILES | [B]c1cc(OC)cc(N(CC2CC2)c2ccc3ncc(-c4cnn(C)c4)nc3c2)c1 |
| InChI | InChI=1S/C23H22BN5O/c1-28-14-16(11-26-28)23-12-25-21-6-5-18(10-22(21)27-23)29(13-15-3-4-15)19-7-17(24)8-20(9-19)30-2/h5-12,14-15H,3-4,13H2,1-2H3 |
| InChIKey | WRKNSHHXAYVJTM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|