C7H9F2N — CID 122647091
N-[(1E,3E)-2,4-difluorobuta-1,3-dienyl]propan-1-imine (PubChem CID 122647091) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is N-[(1E,3E)-2,4-difluorobuta-1,3-dienyl]propan-1-imine.
| Compound Name | N-[(1E,3E)-2,4-difluorobuta-1,3-dienyl]propan-1-imine |
|---|---|
| PubChem CID | 122647091 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | N-[(1E,3E)-2,4-difluorobuta-1,3-dienyl]propan-1-imine |
| SMILES | CC/C=N/C=C(F)\C=C\F |
| InChI | InChI=1S/C7H9F2N/c1-2-5-10-6-7(9)3-4-8/h3-6H,2H2,1H3/b4-3+,7-6+,10-5+ |
| InChIKey | PFIOOUBIIIBTCZ-LTIGWFCASA-N |
| XLogP | 2.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|