C6H8FN — CID 123868124
N-[(1E)-2-fluorobuta-1,3-dienyl]ethanimine (PubChem CID 123868124) has the molecular formula C6H8FN and a molecular weight of 113.13 g/mol. Its IUPAC name is N-[(1E)-2-fluorobuta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E)-2-fluorobuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 123868124 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | N-[(1E)-2-fluorobuta-1,3-dienyl]ethanimine |
| SMILES | C=C/C(F)=C\N=C\C |
| InChI | InChI=1S/C6H8FN/c1-3-6(7)5-8-4-2/h3-5H,1H2,2H3/b6-5+,8-4+ |
| InChIKey | RVOLCOIUFUJBBD-PTFSRLPTSA-N |
| XLogP | 2.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|