About N-[(Z)-prop-1-enyl]ethanimidoyl fluoride
N-[(Z)-prop-1-enyl]ethanimidoyl fluoride (PubChem CID 129055348) has the molecular formula C5H8FN
and a molecular weight of 101.12 g/mol. Its IUPAC name is N-[(Z)-prop-1-enyl]ethanimidoyl fluoride.
Molecular Properties
| Compound Name | N-[(Z)-prop-1-enyl]ethanimidoyl fluoride |
|---|
| PubChem CID | 129055348 |
|---|
| Molecular Formula | C5H8FN |
|---|
| Molecular Weight | 101.12 g/mol |
|---|
| Exact Mass | 101.06 |
|---|
| IUPAC Name | N-[(Z)-prop-1-enyl]ethanimidoyl fluoride |
|---|
| SMILES | C/C=C\N=C(/C)F |
|---|
| InChI | InChI=1S/C5H8FN/c1-3-4-7-5(2)6/h3-4H,1-2H3/b4-3-,7-5+ |
|---|
| InChIKey | GLCVVCZWOVZVNM-QVXLNCAUSA-N |
|---|
| XLogP | 1.91 |
|---|
| TPSA | 12.36 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 1 |
|---|
| Rotatable Bonds | 1 |
|---|
| Heavy Atoms | 7 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 101.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-prop-1-enyl]ethanimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-prop-1-enyl]ethanimidoyl fluoride?
The IUPAC name of N-[(Z)-prop-1-enyl]ethanimidoyl fluoride (CID 129055348) is N-[(Z)-prop-1-enyl]ethanimidoyl fluoride.
What is the SMILES notation for N-[(Z)-prop-1-enyl]ethanimidoyl fluoride?
The canonical SMILES for N-[(Z)-prop-1-enyl]ethanimidoyl fluoride is C/C=C\N=C(/C)F.
What is the InChIKey of N-[(Z)-prop-1-enyl]ethanimidoyl fluoride?
The InChIKey is GLCVVCZWOVZVNM-QVXLNCAUSA-N. The full InChI is InChI=1S/C5H8FN/c1-3-4-7-5(2)6/h3-4H,1-2H3/b4-3-,7-5+.
What are the key properties of N-[(Z)-prop-1-enyl]ethanimidoyl fluoride?
N-[(Z)-prop-1-enyl]ethanimidoyl fluoride has a molecular weight of 101.12 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-prop-1-enyl]ethanimidoyl fluoride is sourced from PubChem (CID 129055348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).