C7H8FN — CID 130206759
(2Z)-N-ethenylpenta-2,4-dienimidoyl fluoride (PubChem CID 130206759) has the molecular formula C7H8FN and a molecular weight of 125.15 g/mol. Its IUPAC name is (2Z)-N-ethenylpenta-2,4-dienimidoyl fluoride.
| Compound Name | (2Z)-N-ethenylpenta-2,4-dienimidoyl fluoride |
|---|---|
| PubChem CID | 130206759 |
| Molecular Formula | C7H8FN |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | (2Z)-N-ethenylpenta-2,4-dienimidoyl fluoride |
| SMILES | C=C/C=C\C(F)=N\C=C |
| InChI | InChI=1S/C7H8FN/c1-3-5-6-7(8)9-4-2/h3-6H,1-2H2/b6-5-,9-7- |
| InChIKey | AYRYRHOAJFFLAH-LZWBOMALSA-N |
| XLogP | 2.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|