About 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate
10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate (PubChem CID 122647751) has the molecular formula C41H76O8
and a molecular weight of 697.05 g/mol. Its IUPAC name is 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate.
Molecular Properties
| Compound Name | 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate |
| PubChem CID | 122647751 |
| Molecular Formula | C41H76O8 |
| Molecular Weight | 697.05 g/mol |
| Exact Mass | 696.55 |
| IUPAC Name | 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCCC(=O)OCC(CC)COC(=O)CCCCCCCCC(=O)OCCCCCCCC |
| InChI | InChI=1S/C41H76O8/c1-4-7-9-11-21-27-33-46-38(42)29-23-17-13-15-19-25-31-40(44)48-35-37(6-3)36-49-41(45)32-26-20-16-14-18-24-30-39(43)47-34-28-22-12-10-8-5-2/h37H,4-36H2,1-3H3 |
| InChIKey | XMAGHTPZYDZYND-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 697.05 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate?
The IUPAC name of 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate (CID 122647751) is 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate.
What is the SMILES notation for 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate?
The canonical SMILES for 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate is CCCCCCCCOC(=O)CCCCCCCCC(=O)OCC(CC)COC(=O)CCCCCCCCC(=O)OCCCCCCCC.
What is the InChIKey of 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate?
The InChIKey is XMAGHTPZYDZYND-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H76O8/c1-4-7-9-11-21-27-33-46-38(42)29-23-17-13-15-19-25-31-40(44)48-35-37(6-3)36-49-41(45)32-26-20-16-14-18-24-30-39(43)47-34-28-22-12-10-8-5-2/h37H,4-36H2,1-3H3.
What are the key properties of 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate?
10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate has a molecular weight of 697.05 g/mol, XLogP of 11.15, 37 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 10-O-[2-[(10-octoxy-10-oxodecanoyl)oxymethyl]butyl] 1-O-octyl decanedioate is sourced from PubChem (CID 122647751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).