About 7-ethylhexadecyl hexanoate
7-ethylhexadecyl hexanoate (PubChem CID 141147025) has the molecular formula C24H48O2
and a molecular weight of 368.65 g/mol. Its IUPAC name is 7-ethylhexadecyl hexanoate.
Molecular Properties
| Compound Name | 7-ethylhexadecyl hexanoate |
| PubChem CID | 141147025 |
| Molecular Formula | C24H48O2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.37 |
| IUPAC Name | 7-ethylhexadecyl hexanoate |
| SMILES | CCCCCCCCCC(CC)CCCCCCOC(=O)CCCCC |
| InChI | InChI=1S/C24H48O2/c1-4-7-9-10-11-12-16-19-23(6-3)20-17-13-14-18-22-26-24(25)21-15-8-5-2/h23H,4-22H2,1-3H3 |
| InChIKey | VJKTXDOCUFXWMZ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-ethylhexadecyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylhexadecyl hexanoate?
The IUPAC name of 7-ethylhexadecyl hexanoate (CID 141147025) is 7-ethylhexadecyl hexanoate.
What is the SMILES notation for 7-ethylhexadecyl hexanoate?
The canonical SMILES for 7-ethylhexadecyl hexanoate is CCCCCCCCCC(CC)CCCCCCOC(=O)CCCCC.
What is the InChIKey of 7-ethylhexadecyl hexanoate?
The InChIKey is VJKTXDOCUFXWMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48O2/c1-4-7-9-10-11-12-16-19-23(6-3)20-17-13-14-18-22-26-24(25)21-15-8-5-2/h23H,4-22H2,1-3H3.
What are the key properties of 7-ethylhexadecyl hexanoate?
7-ethylhexadecyl hexanoate has a molecular weight of 368.65 g/mol, XLogP of 8.23, 20 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylhexadecyl hexanoate is sourced from PubChem (CID 141147025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).