C55H48O4 — CID 122648941
2-[2-[3-[[2-[2-hydroxy-5-methyl-3-(4-phenylphenyl)phenyl]phenyl]methoxy]propoxymethyl]phenyl]-4-methyl-6-(4-phenylphenyl)phenol (PubChem CID 122648941) has the molecular formula C55H48O4 and a molecular weight of 772.99 g/mol. Its IUPAC name is 2-[2-[3-[[2-[2-hydroxy-5-methyl-3-(4-phenylphenyl)phenyl]phenyl]methoxy]propoxymethyl]phenyl]-4-methyl-6-(4-phenylphenyl)phenol.
| Compound Name | 2-[2-[3-[[2-[2-hydroxy-5-methyl-3-(4-phenylphenyl)phenyl]phenyl]methoxy]propoxymethyl]phenyl]-4-methyl-6-(4-phenylphenyl)phenol |
|---|---|
| PubChem CID | 122648941 |
| Molecular Formula | C55H48O4 |
| Molecular Weight | 772.99 g/mol |
| Exact Mass | 772.36 |
| IUPAC Name | 2-[2-[3-[[2-[2-hydroxy-5-methyl-3-(4-phenylphenyl)phenyl]phenyl]methoxy]propoxymethyl]phenyl]-4-methyl-6-(4-phenylphenyl)phenol |
| SMILES | Cc1cc(-c2ccc(-c3ccccc3)cc2)c(O)c(-c2ccccc2COCCCOCc2ccccc2-c2cc(C)cc(-c3ccc(-c4ccccc4)cc3)c2O)c1 |
| InChI | InChI=1S/C55H48O4/c1-38-32-50(44-26-22-42(23-27-44)40-14-5-3-6-15-40)54(56)52(34-38)48-20-11-9-18-46(48)36-58-30-13-31-59-37-47-19-10-12-21-49(47)53-35-39(2)33-51(55(53)57)45-28-24-43(25-29-45)41-16-7-4-8-17-41/h3-12,14-29,32-35,56-57H,13,30-31,36-37H2,1-2H3 |
| InChIKey | VDQYLMPLUSYNAH-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.99 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|