C54H46O5 — CID 134371673
2-[2-[3-[[2-[2-hydroxy-5-methyl-3-(4-phenylphenyl)phenyl]phenyl]methoxy]propoxymethyl]phenyl]-6-(4-phenylphenyl)benzene-1,4-diol (PubChem CID 134371673) has the molecular formula C54H46O5 and a molecular weight of 774.96 g/mol. Its IUPAC name is 2-[2-[3-[[2-[2-hydroxy-5-methyl-3-(4-phenylphenyl)phenyl]phenyl]methoxy]propoxymethyl]phenyl]-6-(4-phenylphenyl)benzene-1,4-diol.
| Compound Name | 2-[2-[3-[[2-[2-hydroxy-5-methyl-3-(4-phenylphenyl)phenyl]phenyl]methoxy]propoxymethyl]phenyl]-6-(4-phenylphenyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 134371673 |
| Molecular Formula | C54H46O5 |
| Molecular Weight | 774.96 g/mol |
| Exact Mass | 774.33 |
| IUPAC Name | 2-[2-[3-[[2-[2-hydroxy-5-methyl-3-(4-phenylphenyl)phenyl]phenyl]methoxy]propoxymethyl]phenyl]-6-(4-phenylphenyl)benzene-1,4-diol |
| SMILES | Cc1cc(-c2ccc(-c3ccccc3)cc2)c(O)c(-c2ccccc2COCCCOCc2ccccc2-c2cc(O)cc(-c3ccc(-c4ccccc4)cc3)c2O)c1 |
| InChI | InChI=1S/C54H46O5/c1-37-31-49(42-25-21-40(22-26-42)38-13-4-2-5-14-38)53(56)51(32-37)47-19-10-8-17-44(47)35-58-29-12-30-59-36-45-18-9-11-20-48(45)52-34-46(55)33-50(54(52)57)43-27-23-41(24-28-43)39-15-6-3-7-16-39/h2-11,13-28,31-34,55-57H,12,29-30,35-36H2,1H3 |
| InChIKey | ZAAWWJNDKNFSSS-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.96 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|