C23H30N2O4 — CID 122650348
9-butoxy-4-[[(2R)-1,4-dioxan-2-yl]methylamino]-1-methyl-6,7-dihydrobenzo[a]quinolizin-2-one (PubChem CID 122650348) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 9-butoxy-4-[[(2R)-1,4-dioxan-2-yl]methylamino]-1-methyl-6,7-dihydrobenzo[a]quinolizin-2-one.
| Compound Name | 9-butoxy-4-[[(2R)-1,4-dioxan-2-yl]methylamino]-1-methyl-6,7-dihydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 122650348 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 9-butoxy-4-[[(2R)-1,4-dioxan-2-yl]methylamino]-1-methyl-6,7-dihydrobenzo[a]quinolizin-2-one |
| SMILES | CCCCOc1ccc2c(c1)CCn1c(NC[C@@H]3COCCO3)cc(=O)c(C)c1-2 |
| InChI | InChI=1S/C23H30N2O4/c1-3-4-9-28-18-5-6-20-17(12-18)7-8-25-22(13-21(26)16(2)23(20)25)24-14-19-15-27-10-11-29-19/h5-6,12-13,19,24H,3-4,7-11,14-15H2,1-2H3/t19-/m1/s1 |
| InChIKey | YGTXDFYPBISHGA-LJQANCHMSA-N |
| XLogP | 3.39 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|