C20H22ClNO5 — CID 170067506
9-(chloromethoxy)-4-[[(2S)-1,4-dioxan-2-yl]methoxy]-1-methyl-6,7-dihydrobenzo[a]quinolizin-2-one (PubChem CID 170067506) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is 9-(chloromethoxy)-4-[[(2S)-1,4-dioxan-2-yl]methoxy]-1-methyl-6,7-dihydrobenzo[a]quinolizin-2-one.
| Compound Name | 9-(chloromethoxy)-4-[[(2S)-1,4-dioxan-2-yl]methoxy]-1-methyl-6,7-dihydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 170067506 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 9-(chloromethoxy)-4-[[(2S)-1,4-dioxan-2-yl]methoxy]-1-methyl-6,7-dihydrobenzo[a]quinolizin-2-one |
| SMILES | Cc1c2n(c(OC[C@@H]3COCCO3)cc1=O)CCc1cc(OCCl)ccc1-2 |
| InChI | InChI=1S/C20H22ClNO5/c1-13-18(23)9-19(26-11-16-10-24-6-7-25-16)22-5-4-14-8-15(27-12-21)2-3-17(14)20(13)22/h2-3,8-9,16H,4-7,10-12H2,1H3/t16-/m0/s1 |
| InChIKey | NTUFDTOFPQBOOY-INIZCTEOSA-N |
| XLogP | 2.75 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|