C11H13N3O2 — CID 122652231
3-(oxan-4-yl)-7H-imidazo[1,5-a]pyrazin-8-one (PubChem CID 122652231) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(oxan-4-yl)-7H-imidazo[1,5-a]pyrazin-8-one.
| Compound Name | 3-(oxan-4-yl)-7H-imidazo[1,5-a]pyrazin-8-one |
|---|---|
| PubChem CID | 122652231 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-(oxan-4-yl)-7H-imidazo[1,5-a]pyrazin-8-one |
| SMILES | O=c1[nH]ccn2c(C3CCOCC3)ncc12 |
| InChI | InChI=1S/C11H13N3O2/c15-11-9-7-13-10(14(9)4-3-12-11)8-1-5-16-6-2-8/h3-4,7-8H,1-2,5-6H2,(H,12,15) |
| InChIKey | ORVNVWKHNZQICB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |