C17H18N4O3 — CID 153159473
4-methyl-12-(oxan-4-yl)-6-oxa-1,5,11,13-tetrazatetracyclo[7.7.0.03,7.011,15]hexadeca-3(7),4,9,12,14-pentaen-16-one (PubChem CID 153159473) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-methyl-12-(oxan-4-yl)-6-oxa-1,5,11,13-tetrazatetracyclo[7.7.0.03,7.011,15]hexadeca-3(7),4,9,12,14-pentaen-16-one.
| Compound Name | 4-methyl-12-(oxan-4-yl)-6-oxa-1,5,11,13-tetrazatetracyclo[7.7.0.03,7.011,15]hexadeca-3(7),4,9,12,14-pentaen-16-one |
|---|---|
| PubChem CID | 153159473 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-methyl-12-(oxan-4-yl)-6-oxa-1,5,11,13-tetrazatetracyclo[7.7.0.03,7.011,15]hexadeca-3(7),4,9,12,14-pentaen-16-one |
| SMILES | Cc1noc2c1Cn1c(cn3c(C4CCOCC4)ncc3c1=O)C2 |
| InChI | InChI=1S/C17H18N4O3/c1-10-13-9-20-12(6-15(13)24-19-10)8-21-14(17(20)22)7-18-16(21)11-2-4-23-5-3-11/h7-8,11H,2-6,9H2,1H3 |
| InChIKey | WCBKKQDVDXSTFO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |