C23H29N3O3 — CID 138709808
7-[(2E,4E)-5-cyclopropyloxy-2-methylhepta-2,4,6-trienyl]-6-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazin-8-one (PubChem CID 138709808) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 7-[(2E,4E)-5-cyclopropyloxy-2-methylhepta-2,4,6-trienyl]-6-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazin-8-one.
| Compound Name | 7-[(2E,4E)-5-cyclopropyloxy-2-methylhepta-2,4,6-trienyl]-6-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazin-8-one |
|---|---|
| PubChem CID | 138709808 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 7-[(2E,4E)-5-cyclopropyloxy-2-methylhepta-2,4,6-trienyl]-6-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazin-8-one |
| SMILES | C=C/C(=C\C=C(/C)Cn1c(C)cn2c(C3CCOCC3)ncc2c1=O)OC1CC1 |
| InChI | InChI=1S/C23H29N3O3/c1-4-19(29-20-7-8-20)6-5-16(2)14-25-17(3)15-26-21(23(25)27)13-24-22(26)18-9-11-28-12-10-18/h4-6,13,15,18,20H,1,7-12,14H2,2-3H3/b16-5+,19-6+ |
| InChIKey | AUILMQRVJBHKDY-KBWHWTGVSA-N |
| XLogP | 3.89 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|