C20H28N4O2 — CID 145155648
3-[(Z,2E)-2-ethylidenehex-3-enyl]-2-methyl-7-(oxepan-4-yl)imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 145155648) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-[(Z,2E)-2-ethylidenehex-3-enyl]-2-methyl-7-(oxepan-4-yl)imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 3-[(Z,2E)-2-ethylidenehex-3-enyl]-2-methyl-7-(oxepan-4-yl)imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 145155648 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 3-[(Z,2E)-2-ethylidenehex-3-enyl]-2-methyl-7-(oxepan-4-yl)imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | C/C=C(\C=C/CC)Cn1c(C)nn2c(C3CCCOCC3)ncc2c1=O |
| InChI | InChI=1S/C20H28N4O2/c1-4-6-8-16(5-2)14-23-15(3)22-24-18(20(23)25)13-21-19(24)17-9-7-11-26-12-10-17/h5-6,8,13,17H,4,7,9-12,14H2,1-3H3/b8-6-,16-5+ |
| InChIKey | XNJYRNIYEJJQOS-LKJHDKRSSA-N |
| XLogP | 3.40 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|