C20H23N5O2 — CID 137002447
11-(3-methylphenyl)-6-(oxan-4-yl)-1,5,7,8,10-pentazatricyclo[7.4.0.03,7]trideca-3,5,8-trien-2-one (PubChem CID 137002447) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 11-(3-methylphenyl)-6-(oxan-4-yl)-1,5,7,8,10-pentazatricyclo[7.4.0.03,7]trideca-3,5,8-trien-2-one.
| Compound Name | 11-(3-methylphenyl)-6-(oxan-4-yl)-1,5,7,8,10-pentazatricyclo[7.4.0.03,7]trideca-3,5,8-trien-2-one |
|---|---|
| PubChem CID | 137002447 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 11-(3-methylphenyl)-6-(oxan-4-yl)-1,5,7,8,10-pentazatricyclo[7.4.0.03,7]trideca-3,5,8-trien-2-one |
| SMILES | Cc1cccc(C2CCn3c(nn4c(C5CCOCC5)ncc4c3=O)N2)c1 |
| InChI | InChI=1S/C20H23N5O2/c1-13-3-2-4-15(11-13)16-5-8-24-19(26)17-12-21-18(14-6-9-27-10-7-14)25(17)23-20(24)22-16/h2-4,11-12,14,16H,5-10H2,1H3,(H,22,23) |
| InChIKey | CVCXTNIGVRHVHO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |