C16H8F3NO2S — CID 122652996
(5-pyridin-3-ylthiophen-2-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone (PubChem CID 122652996) has the molecular formula C16H8F3NO2S and a molecular weight of 335.31 g/mol. Its IUPAC name is (5-pyridin-3-ylthiophen-2-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone.
| Compound Name | (5-pyridin-3-ylthiophen-2-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 122652996 |
| Molecular Formula | C16H8F3NO2S |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (5-pyridin-3-ylthiophen-2-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(-c2cccnc2)s1)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C16H8F3NO2S/c17-10-6-9(13(18)16(22)14(10)19)15(21)12-4-3-11(23-12)8-2-1-5-20-7-8/h1-7,22H |
| InChIKey | HQZBZIAUNHPIAS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|