C22H12ClF3N2O4S2 — CID 155535276
6-chloro-N-[3-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]pyridine-3-sulfonamide (PubChem CID 155535276) has the molecular formula C22H12ClF3N2O4S2 and a molecular weight of 524.93 g/mol. Its IUPAC name is 6-chloro-N-[3-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[3-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 155535276 |
| Molecular Formula | C22H12ClF3N2O4S2 |
| Molecular Weight | 524.93 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | 6-chloro-N-[3-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]pyridine-3-sulfonamide |
| SMILES | O=C(c1ccc(-c2cccc(NS(=O)(=O)c3ccc(Cl)nc3)c2)s1)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C22H12ClF3N2O4S2/c23-18-7-4-13(10-27-18)34(31,32)28-12-3-1-2-11(8-12)16-5-6-17(33-16)21(29)14-9-15(24)20(26)22(30)19(14)25/h1-10,28,30H |
| InChIKey | OECSXGBSPYORAG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.93 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|