C26H24F3N3O3 — CID 122653504
1-[1-oxido-5-[[3-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3-yl]-N-[(3S)-oxolan-3-yl]-2,3-dihydroindole-4-carboxamide (PubChem CID 122653504) has the molecular formula C26H24F3N3O3 and a molecular weight of 483.49 g/mol. Its IUPAC name is 1-[1-oxido-5-[[3-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3-yl]-N-[(3S)-oxolan-3-yl]-2,3-dihydroindole-4-carboxamide.
| Compound Name | 1-[1-oxido-5-[[3-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3-yl]-N-[(3S)-oxolan-3-yl]-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 122653504 |
| Molecular Formula | C26H24F3N3O3 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 1-[1-oxido-5-[[3-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3-yl]-N-[(3S)-oxolan-3-yl]-2,3-dihydroindole-4-carboxamide |
| SMILES | O=C(N[C@H]1CCOC1)c1cccc2c1CCN2c1cc(Cc2cccc(C(F)(F)F)c2)c[n+]([O-])c1 |
| InChI | InChI=1S/C26H24F3N3O3/c27-26(28,29)19-4-1-3-17(12-19)11-18-13-21(15-31(34)14-18)32-9-7-22-23(5-2-6-24(22)32)25(33)30-20-8-10-35-16-20/h1-6,12-15,20H,7-11,16H2,(H,30,33)/t20-/m0/s1 |
| InChIKey | WMFACUQHPBZUMK-FQEVSTJZSA-N |
| XLogP | 4.14 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|