C23H21F3N3O2+ — CID 145181564
1-[1-methoxy-5-[[3-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3-yl]-2,3-dihydroindole-4-carboxamide (PubChem CID 145181564) has the molecular formula C23H21F3N3O2+ and a molecular weight of 428.43 g/mol. Its IUPAC name is 1-[1-methoxy-5-[[3-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3-yl]-2,3-dihydroindole-4-carboxamide.
| Compound Name | 1-[1-methoxy-5-[[3-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3-yl]-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 145181564 |
| Molecular Formula | C23H21F3N3O2+ |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1-[1-methoxy-5-[[3-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3-yl]-2,3-dihydroindole-4-carboxamide |
| SMILES | CO[n+]1cc(Cc2cccc(C(F)(F)F)c2)cc(N2CCc3c(C(N)=O)cccc32)c1 |
| InChI | InChI=1S/C23H20F3N3O2/c1-31-28-13-16(10-15-4-2-5-17(11-15)23(24,25)26)12-18(14-28)29-9-8-19-20(22(27)30)6-3-7-21(19)29/h2-7,11-14H,8-10H2,1H3,(H-,27,30)/p+1 |
| InChIKey | TVIBXTUJQVMSBH-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|