C19H12ClN5 — CID 122654513
5-chloro-3-(1H-indazol-5-yl)-2-phenylimidazo[4,5-b]pyridine (PubChem CID 122654513) has the molecular formula C19H12ClN5 and a molecular weight of 345.79 g/mol. Its IUPAC name is 5-chloro-3-(1H-indazol-5-yl)-2-phenylimidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-3-(1H-indazol-5-yl)-2-phenylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 122654513 |
| Molecular Formula | C19H12ClN5 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 5-chloro-3-(1H-indazol-5-yl)-2-phenylimidazo[4,5-b]pyridine |
| SMILES | Clc1ccc2nc(-c3ccccc3)n(-c3ccc4[nH]ncc4c3)c2n1 |
| InChI | InChI=1S/C19H12ClN5/c20-17-9-8-16-19(23-17)25(18(22-16)12-4-2-1-3-5-12)14-6-7-15-13(10-14)11-21-24-15/h1-11H,(H,21,24) |
| InChIKey | QQBHXOFQBWVVNS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|