C18H11ClFN3O — CID 122656702
5-[2-chloro-6-(6-fluoro-3-pyridinyl)phenyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 122656702) has the molecular formula C18H11ClFN3O and a molecular weight of 339.76 g/mol. Its IUPAC name is 5-[2-chloro-6-(6-fluoro-3-pyridinyl)phenyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[2-chloro-6-(6-fluoro-3-pyridinyl)phenyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 122656702 |
| Molecular Formula | C18H11ClFN3O |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 5-[2-chloro-6-(6-fluoro-3-pyridinyl)phenyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(-c3c(Cl)cccc3-c3ccc(F)nc3)cc2[nH]1 |
| InChI | InChI=1S/C18H11ClFN3O/c19-13-3-1-2-12(11-5-7-16(20)21-9-11)17(13)10-4-6-14-15(8-10)23-18(24)22-14/h1-9H,(H2,22,23,24) |
| InChIKey | MUHKMTGRIWUXMS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|