About 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid)
2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid) (PubChem CID 122657777) has the molecular formula C28H58O9
and a molecular weight of 538.76 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid).
Molecular Properties
| Compound Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid) |
| PubChem CID | 122657777 |
| Molecular Formula | C28H58O9 |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.41 |
| IUPAC Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid) |
| SMILES | CCCCCC(CCC)C(=O)O.CCCCCC(CCC)C(=O)O.OCCOCCOCCOCCO |
| InChI | InChI=1S/2C10H20O2.C8H18O5/c2*1-3-5-6-8-9(7-4-2)10(11)12;9-1-3-11-5-7-13-8-6-12-4-2-10/h2*9H,3-8H2,1-2H3,(H,11,12);9-10H,1-8H2 |
| InChIKey | HLOADPTZXWPYDL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid)?
The IUPAC name of 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid) (CID 122657777) is 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid).
What is the SMILES notation for 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid)?
The canonical SMILES for 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid) is CCCCCC(CCC)C(=O)O.CCCCCC(CCC)C(=O)O.OCCOCCOCCOCCO.
What is the InChIKey of 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid)?
The InChIKey is HLOADPTZXWPYDL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H20O2.C8H18O5/c2*1-3-5-6-8-9(7-4-2)10(11)12;9-1-3-11-5-7-13-8-6-12-4-2-10/h2*9H,3-8H2,1-2H3,(H,11,12);9-10H,1-8H2.
What are the key properties of 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid)?
2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid) has a molecular weight of 538.76 g/mol, XLogP of 5.16, 24 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;bis(2-propylheptanoic acid) is sourced from PubChem (CID 122657777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).