About (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one
(2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one (PubChem CID 122662641) has the molecular formula C23H30O2
and a molecular weight of 338.49 g/mol. Its IUPAC name is (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one |
| PubChem CID | 122662641 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one |
| SMILES | CCc1ccc([C@H]2C=C(CC/C=C(\C)CCC=C(C)C)C(=O)O2)cc1 |
| InChI | InChI=1S/C23H30O2/c1-5-19-12-14-20(15-13-19)22-16-21(23(24)25-22)11-7-10-18(4)9-6-8-17(2)3/h8,10,12-16,22H,5-7,9,11H2,1-4H3/b18-10+/t22-/m1/s1 |
| InChIKey | QJWAXXMFUWHVEF-HPBYZVIZSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one?
The IUPAC name of (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one (CID 122662641) is (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one.
What is the SMILES notation for (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one?
The canonical SMILES for (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one is CCc1ccc([C@H]2C=C(CC/C=C(\C)CCC=C(C)C)C(=O)O2)cc1.
What is the InChIKey of (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one?
The InChIKey is QJWAXXMFUWHVEF-HPBYZVIZSA-N. The full InChI is InChI=1S/C23H30O2/c1-5-19-12-14-20(15-13-19)22-16-21(23(24)25-22)11-7-10-18(4)9-6-8-17(2)3/h8,10,12-16,22H,5-7,9,11H2,1-4H3/b18-10+/t22-/m1/s1.
What are the key properties of (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one?
(2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one has a molecular weight of 338.49 g/mol, XLogP of 6.25, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-ethylphenyl)-2H-furan-5-one is sourced from PubChem (CID 122662641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).