C10H15N — CID 122663407
6-methyl-7-azaspiro[4.5]deca-2,6-diene (PubChem CID 122663407) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 6-methyl-7-azaspiro[4.5]deca-2,6-diene.
| Compound Name | 6-methyl-7-azaspiro[4.5]deca-2,6-diene |
|---|---|
| PubChem CID | 122663407 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 6-methyl-7-azaspiro[4.5]deca-2,6-diene |
| SMILES | CC1=NCCCC12CC=CC2 |
| InChI | InChI=1S/C10H15N/c1-9-10(5-2-3-6-10)7-4-8-11-9/h2-3H,4-8H2,1H3 |
| InChIKey | TXDQXUXMFCESJP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|