C24H21FN6O3S — CID 122663669
1-amino-5-[8-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]-3H-indol-2-one (PubChem CID 122663669) has the molecular formula C24H21FN6O3S and a molecular weight of 492.54 g/mol. Its IUPAC name is 1-amino-5-[8-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]-3H-indol-2-one.
| Compound Name | 1-amino-5-[8-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]-3H-indol-2-one |
|---|---|
| PubChem CID | 122663669 |
| Molecular Formula | C24H21FN6O3S |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 1-amino-5-[8-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]-3H-indol-2-one |
| SMILES | NN1C(=O)Cc2cc(-c3c(-c4ccc(F)cc4)nc4c(N5CCS(=O)(=O)CC5)nccn34)ccc21 |
| InChI | InChI=1S/C24H21FN6O3S/c25-18-4-1-15(2-5-18)21-22(16-3-6-19-17(13-16)14-20(32)31(19)26)30-8-7-27-23(24(30)28-21)29-9-11-35(33,34)12-10-29/h1-8,13H,9-12,14,26H2 |
| InChIKey | MITKXRHTXILYPI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 113.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|