C8H8O2S3 — CID 122664703
3,4-bis(methylsulfanyl)thiophene-2,5-dicarbaldehyde (PubChem CID 122664703) has the molecular formula C8H8O2S3 and a molecular weight of 232.35 g/mol. Its IUPAC name is 3,4-bis(methylsulfanyl)thiophene-2,5-dicarbaldehyde.
| Compound Name | 3,4-bis(methylsulfanyl)thiophene-2,5-dicarbaldehyde |
|---|---|
| PubChem CID | 122664703 |
| Molecular Formula | C8H8O2S3 |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 3,4-bis(methylsulfanyl)thiophene-2,5-dicarbaldehyde |
| SMILES | CSc1c(C=O)sc(C=O)c1SC |
| InChI | InChI=1S/C8H8O2S3/c1-11-7-5(3-9)13-6(4-10)8(7)12-2/h3-4H,1-2H3 |
| InChIKey | OYJUUUWUTLRAEN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|